C13H17F3N2O3 — CID 115521542
2-[4,6-dimethyl-2-oxo-1-(5,5,5-trifluoropentyl)pyrimidin-5-yl]acetic acid (PubChem CID 115521542) has the molecular formula C13H17F3N2O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 2-[4,6-dimethyl-2-oxo-1-(5,5,5-trifluoropentyl)pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[4,6-dimethyl-2-oxo-1-(5,5,5-trifluoropentyl)pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 115521542 |
| Molecular Formula | C13H17F3N2O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[4,6-dimethyl-2-oxo-1-(5,5,5-trifluoropentyl)pyrimidin-5-yl]acetic acid |
| SMILES | Cc1nc(=O)n(CCCCC(F)(F)F)c(C)c1CC(=O)O |
| InChI | InChI=1S/C13H17F3N2O3/c1-8-10(7-11(19)20)9(2)18(12(21)17-8)6-4-3-5-13(14,15)16/h3-7H2,1-2H3,(H,19,20) |
| InChIKey | UKCDMPDPPQMJME-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|