About 4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde
4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde (PubChem CID 115521554) has the molecular formula C9H9ClF3N3O
and a molecular weight of 267.64 g/mol. Its IUPAC name is 4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde.
Molecular Properties
| Compound Name | 4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde |
| PubChem CID | 115521554 |
| Molecular Formula | C9H9ClF3N3O |
| Molecular Weight | 267.64 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde |
| SMILES | O=Cc1c(Cl)ncnc1NCCCC(F)(F)F |
| InChI | InChI=1S/C9H9ClF3N3O/c10-7-6(4-17)8(16-5-15-7)14-3-1-2-9(11,12)13/h4-5H,1-3H2,(H,14,15,16) |
| InChIKey | UVHOJRXKDNKBJR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.64 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde?
The IUPAC name of 4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde (CID 115521554) is 4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde.
What is the SMILES notation for 4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde?
The canonical SMILES for 4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde is O=Cc1c(Cl)ncnc1NCCCC(F)(F)F.
What is the InChIKey of 4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde?
The InChIKey is UVHOJRXKDNKBJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClF3N3O/c10-7-6(4-17)8(16-5-15-7)14-3-1-2-9(11,12)13/h4-5H,1-3H2,(H,14,15,16).
What are the key properties of 4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde?
4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde has a molecular weight of 267.64 g/mol, XLogP of 2.70, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-(4,4,4-trifluorobutylamino)pyrimidine-5-carbaldehyde is sourced from PubChem (CID 115521554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).