C10H10ClF3N6 — CID 115521589
4-chloro-6-pyrazol-1-yl-N-(4,4,4-trifluorobutyl)-1,3,5-triazin-2-amine (PubChem CID 115521589) has the molecular formula C10H10ClF3N6 and a molecular weight of 306.68 g/mol. Its IUPAC name is 4-chloro-6-pyrazol-1-yl-N-(4,4,4-trifluorobutyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-pyrazol-1-yl-N-(4,4,4-trifluorobutyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 115521589 |
| Molecular Formula | C10H10ClF3N6 |
| Molecular Weight | 306.68 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 4-chloro-6-pyrazol-1-yl-N-(4,4,4-trifluorobutyl)-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)CCCNc1nc(Cl)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C10H10ClF3N6/c11-7-17-8(15-4-1-3-10(12,13)14)19-9(18-7)20-6-2-5-16-20/h2,5-6H,1,3-4H2,(H,15,17,18,19) |
| InChIKey | FAUCYKQVTQPPRC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.68 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|