C11H12ClF3N6 — CID 115521625
4-chloro-6-pyrazol-1-yl-N-(5,5,5-trifluoropentyl)-1,3,5-triazin-2-amine (PubChem CID 115521625) has the molecular formula C11H12ClF3N6 and a molecular weight of 320.71 g/mol. Its IUPAC name is 4-chloro-6-pyrazol-1-yl-N-(5,5,5-trifluoropentyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-pyrazol-1-yl-N-(5,5,5-trifluoropentyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 115521625 |
| Molecular Formula | C11H12ClF3N6 |
| Molecular Weight | 320.71 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-chloro-6-pyrazol-1-yl-N-(5,5,5-trifluoropentyl)-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)CCCCNc1nc(Cl)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C11H12ClF3N6/c12-8-18-9(16-5-2-1-4-11(13,14)15)20-10(19-8)21-7-3-6-17-21/h3,6-7H,1-2,4-5H2,(H,16,18,19,20) |
| InChIKey | ZIXAXNGYHKGXRZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.71 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|