C8H11F3N2O3S2 — CID 115521685
4-methyl-2-oxo-N-(4,4,4-trifluorobutyl)-3H-1,3-thiazole-5-sulfonamide (PubChem CID 115521685) has the molecular formula C8H11F3N2O3S2 and a molecular weight of 304.32 g/mol. Its IUPAC name is 4-methyl-2-oxo-N-(4,4,4-trifluorobutyl)-3H-1,3-thiazole-5-sulfonamide.
| Compound Name | 4-methyl-2-oxo-N-(4,4,4-trifluorobutyl)-3H-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 115521685 |
| Molecular Formula | C8H11F3N2O3S2 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 4-methyl-2-oxo-N-(4,4,4-trifluorobutyl)-3H-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C8H11F3N2O3S2/c1-5-6(17-7(14)13-5)18(15,16)12-4-2-3-8(9,10)11/h12H,2-4H2,1H3,(H,13,14) |
| InChIKey | CCVXXQRDFDDFRH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|