About 2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline
2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline (PubChem CID 115521931) has the molecular formula C13H16F3N5
and a molecular weight of 299.30 g/mol. Its IUPAC name is 2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline.
Molecular Properties
| Compound Name | 2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline |
| PubChem CID | 115521931 |
| Molecular Formula | C13H16F3N5 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline |
| SMILES | Cc1ccc(-c2nnnn2CCCCC(F)(F)F)cc1N |
| InChI | InChI=1S/C13H16F3N5/c1-9-4-5-10(8-11(9)17)12-18-19-20-21(12)7-3-2-6-13(14,15)16/h4-5,8H,2-3,6-7,17H2,1H3 |
| InChIKey | WQCKKBGKTXPTND-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline?
The IUPAC name of 2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline (CID 115521931) is 2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline.
What is the SMILES notation for 2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline?
The canonical SMILES for 2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline is Cc1ccc(-c2nnnn2CCCCC(F)(F)F)cc1N.
What is the InChIKey of 2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline?
The InChIKey is WQCKKBGKTXPTND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F3N5/c1-9-4-5-10(8-11(9)17)12-18-19-20-21(12)7-3-2-6-13(14,15)16/h4-5,8H,2-3,6-7,17H2,1H3.
What are the key properties of 2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline?
2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline has a molecular weight of 299.30 g/mol, XLogP of 2.96, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline is sourced from PubChem (CID 115521931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).