C13H16F3N5 — CID 115521943
3-methyl-2-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline (PubChem CID 115521943) has the molecular formula C13H16F3N5 and a molecular weight of 299.30 g/mol. Its IUPAC name is 3-methyl-2-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline.
| Compound Name | 3-methyl-2-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 115521943 |
| Molecular Formula | C13H16F3N5 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-methyl-2-[1-(5,5,5-trifluoropentyl)tetrazol-5-yl]aniline |
| SMILES | Cc1cccc(N)c1-c1nnnn1CCCCC(F)(F)F |
| InChI | InChI=1S/C13H16F3N5/c1-9-5-4-6-10(17)11(9)12-18-19-20-21(12)8-3-2-7-13(14,15)16/h4-6H,2-3,7-8,17H2,1H3 |
| InChIKey | QLIIYZHAEJWFGA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|