C10H13F3N4O2S2 — CID 115522035
6-(methylamino)-N-(4,4,4-trifluorobutyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 115522035) has the molecular formula C10H13F3N4O2S2 and a molecular weight of 342.37 g/mol. Its IUPAC name is 6-(methylamino)-N-(4,4,4-trifluorobutyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide.
| Compound Name | 6-(methylamino)-N-(4,4,4-trifluorobutyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 115522035 |
| Molecular Formula | C10H13F3N4O2S2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 6-(methylamino)-N-(4,4,4-trifluorobutyl)imidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | CNc1nc2sccn2c1S(=O)(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C10H13F3N4O2S2/c1-14-7-8(17-5-6-20-9(17)16-7)21(18,19)15-4-2-3-10(11,12)13/h5-6,14-15H,2-4H2,1H3 |
| InChIKey | FZZILKLGLRYHSR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|