C13H20F3NO3 — CID 115522225
2,4-dimethyl-6-oxo-1-(5,5,5-trifluoropentyl)piperidine-3-carboxylic acid (PubChem CID 115522225) has the molecular formula C13H20F3NO3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2,4-dimethyl-6-oxo-1-(5,5,5-trifluoropentyl)piperidine-3-carboxylic acid.
| Compound Name | 2,4-dimethyl-6-oxo-1-(5,5,5-trifluoropentyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 115522225 |
| Molecular Formula | C13H20F3NO3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2,4-dimethyl-6-oxo-1-(5,5,5-trifluoropentyl)piperidine-3-carboxylic acid |
| SMILES | CC1CC(=O)N(CCCCC(F)(F)F)C(C)C1C(=O)O |
| InChI | InChI=1S/C13H20F3NO3/c1-8-7-10(18)17(9(2)11(8)12(19)20)6-4-3-5-13(14,15)16/h8-9,11H,3-7H2,1-2H3,(H,19,20) |
| InChIKey | YHFQIJUUPKHKPU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|