About N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide
N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide (PubChem CID 115522336) has the molecular formula C8H13F3N2
and a molecular weight of 194.20 g/mol. Its IUPAC name is N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide.
Molecular Properties
| Compound Name | N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide |
| PubChem CID | 115522336 |
| Molecular Formula | C8H13F3N2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide |
| SMILES | N/C(=N\CCCC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C8H13F3N2/c9-8(10,11)4-1-5-13-7(12)6-2-3-6/h6H,1-5H2,(H2,12,13) |
| InChIKey | KBMWLRKKXWEVND-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide?
The IUPAC name of N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide (CID 115522336) is N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide.
What is the SMILES notation for N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide?
The canonical SMILES for N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide is N/C(=N\CCCC(F)(F)F)C1CC1.
What is the InChIKey of N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide?
The InChIKey is KBMWLRKKXWEVND-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3N2/c9-8(10,11)4-1-5-13-7(12)6-2-3-6/h6H,1-5H2,(H2,12,13).
What are the key properties of N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide?
N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide has a molecular weight of 194.20 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4,4,4-trifluorobutyl)cyclopropanecarboximidamide is sourced from PubChem (CID 115522336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).