C10H15ClF3N3 — CID 115522356
3-chloro-5-propan-2-yl-4-(5,5,5-trifluoropentyl)-1,2,4-triazole (PubChem CID 115522356) has the molecular formula C10H15ClF3N3 and a molecular weight of 269.70 g/mol. Its IUPAC name is 3-chloro-5-propan-2-yl-4-(5,5,5-trifluoropentyl)-1,2,4-triazole.
| Compound Name | 3-chloro-5-propan-2-yl-4-(5,5,5-trifluoropentyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 115522356 |
| Molecular Formula | C10H15ClF3N3 |
| Molecular Weight | 269.70 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 3-chloro-5-propan-2-yl-4-(5,5,5-trifluoropentyl)-1,2,4-triazole |
| SMILES | CC(C)c1nnc(Cl)n1CCCCC(F)(F)F |
| InChI | InChI=1S/C10H15ClF3N3/c1-7(2)8-15-16-9(11)17(8)6-4-3-5-10(12,13)14/h7H,3-6H2,1-2H3 |
| InChIKey | JZNFOHRJIFCEQE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.70 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|