C12H19F3N2O2 — CID 115522526
3-ethyl-3-methyl-1-(5,5,5-trifluoropentyl)piperazine-2,5-dione (PubChem CID 115522526) has the molecular formula C12H19F3N2O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 3-ethyl-3-methyl-1-(5,5,5-trifluoropentyl)piperazine-2,5-dione.
| Compound Name | 3-ethyl-3-methyl-1-(5,5,5-trifluoropentyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 115522526 |
| Molecular Formula | C12H19F3N2O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 3-ethyl-3-methyl-1-(5,5,5-trifluoropentyl)piperazine-2,5-dione |
| SMILES | CCC1(C)NC(=O)CN(CCCCC(F)(F)F)C1=O |
| InChI | InChI=1S/C12H19F3N2O2/c1-3-11(2)10(19)17(8-9(18)16-11)7-5-4-6-12(13,14)15/h3-8H2,1-2H3,(H,16,18) |
| InChIKey | SYAOHVQQRVKQIX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|