C11H17F3N4O2S — CID 115522772
4-[(cyclopropylamino)methyl]-N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide (PubChem CID 115522772) has the molecular formula C11H17F3N4O2S and a molecular weight of 326.34 g/mol. Its IUPAC name is 4-[(cyclopropylamino)methyl]-N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-[(cyclopropylamino)methyl]-N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 115522772 |
| Molecular Formula | C11H17F3N4O2S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 4-[(cyclopropylamino)methyl]-N-(4,4,4-trifluorobutyl)-1H-pyrazole-5-sulfonamide |
| SMILES | O=S(=O)(NCCCC(F)(F)F)c1[nH]ncc1CNC1CC1 |
| InChI | InChI=1S/C11H17F3N4O2S/c12-11(13,14)4-1-5-17-21(19,20)10-8(7-16-18-10)6-15-9-2-3-9/h7,9,15,17H,1-6H2,(H,16,18) |
| InChIKey | CJSWTDOVQVVAKJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|