C11H16F3N3O2S — CID 115522827
5-(methylaminomethyl)-N-(4,4,4-trifluorobutyl)pyridine-2-sulfonamide (PubChem CID 115522827) has the molecular formula C11H16F3N3O2S and a molecular weight of 311.33 g/mol. Its IUPAC name is 5-(methylaminomethyl)-N-(4,4,4-trifluorobutyl)pyridine-2-sulfonamide.
| Compound Name | 5-(methylaminomethyl)-N-(4,4,4-trifluorobutyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 115522827 |
| Molecular Formula | C11H16F3N3O2S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 5-(methylaminomethyl)-N-(4,4,4-trifluorobutyl)pyridine-2-sulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)NCCCC(F)(F)F)nc1 |
| InChI | InChI=1S/C11H16F3N3O2S/c1-15-7-9-3-4-10(16-8-9)20(18,19)17-6-2-5-11(12,13)14/h3-4,8,15,17H,2,5-7H2,1H3 |
| InChIKey | RXNDUNLTSLTKMR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|