C9H11F3N2O2S — CID 115523003
methyl 2-(4,4,4-trifluorobutylamino)-1,3-thiazole-5-carboxylate (PubChem CID 115523003) has the molecular formula C9H11F3N2O2S and a molecular weight of 268.26 g/mol. Its IUPAC name is methyl 2-(4,4,4-trifluorobutylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(4,4,4-trifluorobutylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 115523003 |
| Molecular Formula | C9H11F3N2O2S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | methyl 2-(4,4,4-trifluorobutylamino)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(NCCCC(F)(F)F)s1 |
| InChI | InChI=1S/C9H11F3N2O2S/c1-16-7(15)6-5-14-8(17-6)13-4-2-3-9(10,11)12/h5H,2-4H2,1H3,(H,13,14) |
| InChIKey | HJCKBZHYGOMPKT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|