C11H14F3N7 — CID 115523188
6-pyrazol-1-yl-2-N-(5,5,5-trifluoropentyl)-1,3,5-triazine-2,4-diamine (PubChem CID 115523188) has the molecular formula C11H14F3N7 and a molecular weight of 301.28 g/mol. Its IUPAC name is 6-pyrazol-1-yl-2-N-(5,5,5-trifluoropentyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-pyrazol-1-yl-2-N-(5,5,5-trifluoropentyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 115523188 |
| Molecular Formula | C11H14F3N7 |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 6-pyrazol-1-yl-2-N-(5,5,5-trifluoropentyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(NCCCCC(F)(F)F)nc(-n2cccn2)n1 |
| InChI | InChI=1S/C11H14F3N7/c12-11(13,14)4-1-2-5-16-9-18-8(15)19-10(20-9)21-7-3-6-17-21/h3,6-7H,1-2,4-5H2,(H3,15,16,18,19,20) |
| InChIKey | AQNUXZLYMYJTRN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|