C13H21F3N4 — CID 115523193
2-ethyl-6-N,5-dimethyl-4-N-(5,5,5-trifluoropentyl)pyrimidine-4,6-diamine (PubChem CID 115523193) has the molecular formula C13H21F3N4 and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-ethyl-6-N,5-dimethyl-4-N-(5,5,5-trifluoropentyl)pyrimidine-4,6-diamine.
| Compound Name | 2-ethyl-6-N,5-dimethyl-4-N-(5,5,5-trifluoropentyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 115523193 |
| Molecular Formula | C13H21F3N4 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-ethyl-6-N,5-dimethyl-4-N-(5,5,5-trifluoropentyl)pyrimidine-4,6-diamine |
| SMILES | CCc1nc(NC)c(C)c(NCCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C13H21F3N4/c1-4-10-19-11(17-3)9(2)12(20-10)18-8-6-5-7-13(14,15)16/h4-8H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | NELOZVMQTJUPMG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|