About 6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine
6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine (PubChem CID 115523318) has the molecular formula C9H14F3N5
and a molecular weight of 249.24 g/mol. Its IUPAC name is 6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine |
| PubChem CID | 115523318 |
| Molecular Formula | C9H14F3N5 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine |
| SMILES | NNc1cncc(NCCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H14F3N5/c10-9(11,12)3-1-2-4-15-7-5-14-6-8(16-7)17-13/h5-6H,1-4,13H2,(H2,15,16,17) |
| InChIKey | USXIQGFUYDFDCM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine?
The IUPAC name of 6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine (CID 115523318) is 6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine.
What is the SMILES notation for 6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine?
The canonical SMILES for 6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine is NNc1cncc(NCCCCC(F)(F)F)n1.
What is the InChIKey of 6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine?
The InChIKey is USXIQGFUYDFDCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3N5/c10-9(11,12)3-1-2-4-15-7-5-14-6-8(16-7)17-13/h5-6H,1-4,13H2,(H2,15,16,17).
What are the key properties of 6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine?
6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine has a molecular weight of 249.24 g/mol, XLogP of 1.91, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydrazinyl-N-(5,5,5-trifluoropentyl)pyrazin-2-amine is sourced from PubChem (CID 115523318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).