C16H25F2N3 — CID 115523506
N-[[4-(difluoromethyl)phenyl]methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine (PubChem CID 115523506) has the molecular formula C16H25F2N3 and a molecular weight of 297.39 g/mol. Its IUPAC name is N-[[4-(difluoromethyl)phenyl]methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine.
| Compound Name | N-[[4-(difluoromethyl)phenyl]methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 115523506 |
| Molecular Formula | C16H25F2N3 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | N-[[4-(difluoromethyl)phenyl]methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine |
| SMILES | CN1CCN(CCCNCc2ccc(C(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H25F2N3/c1-20-9-11-21(12-10-20)8-2-7-19-13-14-3-5-15(6-4-14)16(17)18/h3-6,16,19H,2,7-13H2,1H3 |
| InChIKey | MNHSGJKATLRJSI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|