C14H22F2N2 — CID 115523961
N-[[4-(difluoromethyl)phenyl]methyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine (PubChem CID 115523961) has the molecular formula C14H22F2N2 and a molecular weight of 256.34 g/mol. Its IUPAC name is N-[[4-(difluoromethyl)phenyl]methyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-[[4-(difluoromethyl)phenyl]methyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 115523961 |
| Molecular Formula | C14H22F2N2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | N-[[4-(difluoromethyl)phenyl]methyl]-N'-methyl-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)N(C)CCNCc1ccc(C(F)F)cc1 |
| InChI | InChI=1S/C14H22F2N2/c1-11(2)18(3)9-8-17-10-12-4-6-13(7-5-12)14(15)16/h4-7,11,14,17H,8-10H2,1-3H3 |
| InChIKey | ZAMWDHCMPGTOPJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|