C13H19F2NO — CID 115524024
2-[[4-(difluoromethyl)phenyl]methylamino]-2-methylbutan-1-ol (PubChem CID 115524024) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-[[4-(difluoromethyl)phenyl]methylamino]-2-methylbutan-1-ol.
| Compound Name | 2-[[4-(difluoromethyl)phenyl]methylamino]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 115524024 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2-[[4-(difluoromethyl)phenyl]methylamino]-2-methylbutan-1-ol |
| SMILES | CCC(C)(CO)NCc1ccc(C(F)F)cc1 |
| InChI | InChI=1S/C13H19F2NO/c1-3-13(2,9-17)16-8-10-4-6-11(7-5-10)12(14)15/h4-7,12,16-17H,3,8-9H2,1-2H3 |
| InChIKey | WWCMHKMIBIUPJY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |