C20H40O2Si2 — CID 11552406
3,8-diethyl-4,7-bis(trimethylsilyl)deca-4,5,6-triene-3,8-diol (PubChem CID 11552406) has the molecular formula C20H40O2Si2 and a molecular weight of 368.71 g/mol. Its IUPAC name is 3,8-diethyl-4,7-bis(trimethylsilyl)deca-4,5,6-triene-3,8-diol.
| Compound Name | 3,8-diethyl-4,7-bis(trimethylsilyl)deca-4,5,6-triene-3,8-diol |
|---|---|
| PubChem CID | 11552406 |
| Molecular Formula | C20H40O2Si2 |
| Molecular Weight | 368.71 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 3,8-diethyl-4,7-bis(trimethylsilyl)deca-4,5,6-triene-3,8-diol |
| SMILES | CCC(O)(CC)C(=C=C=C(C(O)(CC)CC)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C20H40O2Si2/c1-11-19(21,12-2)17(23(5,6)7)15-16-18(24(8,9)10)20(22,13-3)14-4/h21-22H,11-14H2,1-10H3/b18-17- |
| InChIKey | RKQSHDQQKCQTGP-ZCXUNETKSA-N |
| XLogP | 5.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.71 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|