C15H16F2N2 — CID 115524164
(1R)-N-[[4-(difluoromethyl)phenyl]methyl]-1-pyridin-3-ylethanamine (PubChem CID 115524164) has the molecular formula C15H16F2N2 and a molecular weight of 262.30 g/mol. Its IUPAC name is (1R)-N-[[4-(difluoromethyl)phenyl]methyl]-1-pyridin-3-ylethanamine.
| Compound Name | (1R)-N-[[4-(difluoromethyl)phenyl]methyl]-1-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 115524164 |
| Molecular Formula | C15H16F2N2 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | (1R)-N-[[4-(difluoromethyl)phenyl]methyl]-1-pyridin-3-ylethanamine |
| SMILES | C[C@@H](NCc1ccc(C(F)F)cc1)c1cccnc1 |
| InChI | InChI=1S/C15H16F2N2/c1-11(14-3-2-8-18-10-14)19-9-12-4-6-13(7-5-12)15(16)17/h2-8,10-11,15,19H,9H2,1H3/t11-/m1/s1 |
| InChIKey | BFGSGVZOYSBCRQ-LLVKDONJSA-N |
| XLogP | 3.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |