C15H24F2N2 — CID 115524220
N-butyl-1-[4-(difluoromethyl)phenyl]-N-ethylethane-1,2-diamine (PubChem CID 115524220) has the molecular formula C15H24F2N2 and a molecular weight of 270.37 g/mol. Its IUPAC name is N-butyl-1-[4-(difluoromethyl)phenyl]-N-ethylethane-1,2-diamine.
| Compound Name | N-butyl-1-[4-(difluoromethyl)phenyl]-N-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 115524220 |
| Molecular Formula | C15H24F2N2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | N-butyl-1-[4-(difluoromethyl)phenyl]-N-ethylethane-1,2-diamine |
| SMILES | CCCCN(CC)C(CN)c1ccc(C(F)F)cc1 |
| InChI | InChI=1S/C15H24F2N2/c1-3-5-10-19(4-2)14(11-18)12-6-8-13(9-7-12)15(16)17/h6-9,14-15H,3-5,10-11,18H2,1-2H3 |
| InChIKey | YMZDHBGOCVJBNZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |