C22H26O5 — CID 11552436
(1R,2S,3R,4R,6R)-4-[2-[(4-ethenylphenyl)methyl]phenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol (PubChem CID 11552436) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is (1R,2S,3R,4R,6R)-4-[2-[(4-ethenylphenyl)methyl]phenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol.
| Compound Name | (1R,2S,3R,4R,6R)-4-[2-[(4-ethenylphenyl)methyl]phenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 11552436 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (1R,2S,3R,4R,6R)-4-[2-[(4-ethenylphenyl)methyl]phenoxy]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
| SMILES | C=Cc1ccc(Cc2ccccc2O[C@@H]2C[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C22H26O5/c1-2-14-7-9-15(10-8-14)11-16-5-3-4-6-18(16)27-19-12-17(13-23)20(24)22(26)21(19)25/h2-10,17,19-26H,1,11-13H2/t17-,19-,20-,21+,22+/m1/s1 |
| InChIKey | XMCDYVKGGTVBKO-IWTFSIHTSA-N |
| XLogP | 1.76 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |