C18H19N3O4S — CID 11552503
N-(diaminomethylidene)-5,5-dioxo-10-propan-2-yl-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide (PubChem CID 11552503) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is N-(diaminomethylidene)-5,5-dioxo-10-propan-2-yl-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide.
| Compound Name | N-(diaminomethylidene)-5,5-dioxo-10-propan-2-yl-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
|---|---|
| PubChem CID | 11552503 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-(diaminomethylidene)-5,5-dioxo-10-propan-2-yl-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
| SMILES | CC(C)c1cccc2c1Oc1ccc(C(=O)N=C(N)N)cc1S(=O)(=O)C2 |
| InChI | InChI=1S/C18H19N3O4S/c1-10(2)13-5-3-4-12-9-26(23,24)15-8-11(17(22)21-18(19)20)6-7-14(15)25-16(12)13/h3-8,10H,9H2,1-2H3,(H4,19,20,21,22) |
| InChIKey | FSZJVTMZCPBYDY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|