About methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate
methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate (PubChem CID 11552555) has the molecular formula C12H13IN2O4
and a molecular weight of 376.15 g/mol. Its IUPAC name is methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate.
Molecular Properties
| Compound Name | methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate |
| PubChem CID | 11552555 |
| Molecular Formula | C12H13IN2O4 |
| Molecular Weight | 376.15 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate |
| SMILES | COC(=O)N1C=C[C@]2(C#N)C(I)[C@H]1OC(=O)C2(C)C |
| InChI | InChI=1S/C12H13IN2O4/c1-11(2)9(16)19-8-7(13)12(11,6-14)4-5-15(8)10(17)18-3/h4-5,7-8H,1-3H3/t7?,8-,12+/m1/s1 |
| InChIKey | HGHPUAAXGDZUQP-RDNCKJRISA-N |
| XLogP | 1.80 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.15 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate?
The IUPAC name of methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate (CID 11552555) is methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate.
What is the SMILES notation for methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate?
The canonical SMILES for methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate is COC(=O)N1C=C[C@]2(C#N)C(I)[C@H]1OC(=O)C2(C)C.
What is the InChIKey of methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate?
The InChIKey is HGHPUAAXGDZUQP-RDNCKJRISA-N. The full InChI is InChI=1S/C12H13IN2O4/c1-11(2)9(16)19-8-7(13)12(11,6-14)4-5-15(8)10(17)18-3/h4-5,7-8H,1-3H3/t7?,8-,12+/m1/s1.
What are the key properties of methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate?
methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate has a molecular weight of 376.15 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1R,5S)-5-cyano-9-iodo-4,4-dimethyl-3-oxo-2-oxa-8-azabicyclo[3.3.1]non-6-ene-8-carboxylate is sourced from PubChem (CID 11552555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).