C16H15F2NO — CID 115526259
N-[[3-(difluoromethyl)phenyl]methyl]-2,3-dihydro-1-benzofuran-5-amine (PubChem CID 115526259) has the molecular formula C16H15F2NO and a molecular weight of 275.30 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]-2,3-dihydro-1-benzofuran-5-amine.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]-2,3-dihydro-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 115526259 |
| Molecular Formula | C16H15F2NO |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]-2,3-dihydro-1-benzofuran-5-amine |
| SMILES | FC(F)c1cccc(CNc2ccc3c(c2)CCO3)c1 |
| InChI | InChI=1S/C16H15F2NO/c17-16(18)13-3-1-2-11(8-13)10-19-14-4-5-15-12(9-14)6-7-20-15/h1-5,8-9,16,19H,6-7,10H2 |
| InChIKey | GYVJQGHDZNUVRC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|