C17H26F2N2 — CID 115526373
N-[[3-(difluoromethyl)phenyl]methyl]-2-methyl-3-piperidin-1-ylpropan-1-amine (PubChem CID 115526373) has the molecular formula C17H26F2N2 and a molecular weight of 296.40 g/mol. Its IUPAC name is N-[[3-(difluoromethyl)phenyl]methyl]-2-methyl-3-piperidin-1-ylpropan-1-amine.
| Compound Name | N-[[3-(difluoromethyl)phenyl]methyl]-2-methyl-3-piperidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 115526373 |
| Molecular Formula | C17H26F2N2 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | N-[[3-(difluoromethyl)phenyl]methyl]-2-methyl-3-piperidin-1-ylpropan-1-amine |
| SMILES | CC(CNCc1cccc(C(F)F)c1)CN1CCCCC1 |
| InChI | InChI=1S/C17H26F2N2/c1-14(13-21-8-3-2-4-9-21)11-20-12-15-6-5-7-16(10-15)17(18)19/h5-7,10,14,17,20H,2-4,8-9,11-13H2,1H3 |
| InChIKey | QLBJKZIOGUMQNC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |