C16H12F2N2S — CID 115528326
4-[3-(difluoromethyl)phenyl]-2-phenyl-1,3-thiazol-5-amine (PubChem CID 115528326) has the molecular formula C16H12F2N2S and a molecular weight of 302.35 g/mol. Its IUPAC name is 4-[3-(difluoromethyl)phenyl]-2-phenyl-1,3-thiazol-5-amine.
| Compound Name | 4-[3-(difluoromethyl)phenyl]-2-phenyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 115528326 |
| Molecular Formula | C16H12F2N2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-[3-(difluoromethyl)phenyl]-2-phenyl-1,3-thiazol-5-amine |
| SMILES | Nc1sc(-c2ccccc2)nc1-c1cccc(C(F)F)c1 |
| InChI | InChI=1S/C16H12F2N2S/c17-14(18)12-8-4-7-11(9-12)13-15(19)21-16(20-13)10-5-2-1-3-6-10/h1-9,14H,19H2 |
| InChIKey | KTSCLKBLOVOZAL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |