C14H15F2N3 — CID 115528416
2-[3-(difluoromethyl)phenyl]-6-propan-2-ylpyrimidin-4-amine (PubChem CID 115528416) has the molecular formula C14H15F2N3 and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)phenyl]-6-propan-2-ylpyrimidin-4-amine.
| Compound Name | 2-[3-(difluoromethyl)phenyl]-6-propan-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115528416 |
| Molecular Formula | C14H15F2N3 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-[3-(difluoromethyl)phenyl]-6-propan-2-ylpyrimidin-4-amine |
| SMILES | CC(C)c1cc(N)nc(-c2cccc(C(F)F)c2)n1 |
| InChI | InChI=1S/C14H15F2N3/c1-8(2)11-7-12(17)19-14(18-11)10-5-3-4-9(6-10)13(15)16/h3-8,13H,1-2H3,(H2,17,18,19) |
| InChIKey | IHSVVSQXKUQOCR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |