C12H14BrN5 — CID 115528480
5-bromo-2-(2-methylpyrimidin-4-yl)-6-propylpyrimidin-4-amine (PubChem CID 115528480) has the molecular formula C12H14BrN5 and a molecular weight of 308.18 g/mol. Its IUPAC name is 5-bromo-2-(2-methylpyrimidin-4-yl)-6-propylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(2-methylpyrimidin-4-yl)-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115528480 |
| Molecular Formula | C12H14BrN5 |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 5-bromo-2-(2-methylpyrimidin-4-yl)-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(-c2ccnc(C)n2)nc(N)c1Br |
| InChI | InChI=1S/C12H14BrN5/c1-3-4-8-10(13)11(14)18-12(17-8)9-5-6-15-7(2)16-9/h5-6H,3-4H2,1-2H3,(H2,14,17,18) |
| InChIKey | YNFMWWZKGRNVIG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |