C22H27FO5 — CID 11552864
(1R,2R,3S,4R,5R)-1-[5-[(4-ethylphenyl)methyl]-2-fluorophenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol (PubChem CID 11552864) has the molecular formula C22H27FO5 and a molecular weight of 390.45 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R)-1-[5-[(4-ethylphenyl)methyl]-2-fluorophenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol.
| Compound Name | (1R,2R,3S,4R,5R)-1-[5-[(4-ethylphenyl)methyl]-2-fluorophenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11552864 |
| Molecular Formula | C22H27FO5 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (1R,2R,3S,4R,5R)-1-[5-[(4-ethylphenyl)methyl]-2-fluorophenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol |
| SMILES | CCc1ccc(Cc2ccc(F)c([C@]3(O)C[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1 |
| InChI | InChI=1S/C22H27FO5/c1-2-13-3-5-14(6-4-13)9-15-7-8-18(23)17(10-15)22(28)11-16(12-24)19(25)20(26)21(22)27/h3-8,10,16,19-21,24-28H,2,9,11-12H2,1H3/t16-,19-,20+,21-,22-/m1/s1 |
| InChIKey | FDBVDJMUOABVNT-RECXWPGBSA-N |
| XLogP | 1.26 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |