C21H34O3Si2 — CID 11552875
ethyl 1-[3-hydroxy-1,5-bis(trimethylsilyl)penta-1,4-diyn-3-yl]-3-methylidenecyclohexane-1-carboxylate (PubChem CID 11552875) has the molecular formula C21H34O3Si2 and a molecular weight of 390.67 g/mol. Its IUPAC name is ethyl 1-[3-hydroxy-1,5-bis(trimethylsilyl)penta-1,4-diyn-3-yl]-3-methylidenecyclohexane-1-carboxylate.
| Compound Name | ethyl 1-[3-hydroxy-1,5-bis(trimethylsilyl)penta-1,4-diyn-3-yl]-3-methylidenecyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11552875 |
| Molecular Formula | C21H34O3Si2 |
| Molecular Weight | 390.67 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | ethyl 1-[3-hydroxy-1,5-bis(trimethylsilyl)penta-1,4-diyn-3-yl]-3-methylidenecyclohexane-1-carboxylate |
| SMILES | C=C1CCCC(C(=O)OCC)(C(O)(C#C[Si](C)(C)C)C#C[Si](C)(C)C)C1 |
| InChI | InChI=1S/C21H34O3Si2/c1-9-24-19(22)20(12-10-11-18(2)17-20)21(23,13-15-25(3,4)5)14-16-26(6,7)8/h23H,2,9-12,17H2,1,3-8H3 |
| InChIKey | LOCFWZCXNTZBSX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.67 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|