C15H17F2NO3 — CID 115528867
2-[3-(difluoromethyl)phenyl]-1-ethyl-6-oxopiperidine-3-carboxylic acid (PubChem CID 115528867) has the molecular formula C15H17F2NO3 and a molecular weight of 297.30 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)phenyl]-1-ethyl-6-oxopiperidine-3-carboxylic acid.
| Compound Name | 2-[3-(difluoromethyl)phenyl]-1-ethyl-6-oxopiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 115528867 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[3-(difluoromethyl)phenyl]-1-ethyl-6-oxopiperidine-3-carboxylic acid |
| SMILES | CCN1C(=O)CCC(C(=O)O)C1c1cccc(C(F)F)c1 |
| InChI | InChI=1S/C15H17F2NO3/c1-2-18-12(19)7-6-11(15(20)21)13(18)9-4-3-5-10(8-9)14(16)17/h3-5,8,11,13-14H,2,6-7H2,1H3,(H,20,21) |
| InChIKey | WASHNGPQHLIWIV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |