C21H24N6S — CID 11552915
N',N'-diethyl-N-(2-thiophen-2-ylpyrimido[5,4-c]cinnolin-4-yl)propane-1,3-diamine (PubChem CID 11552915) has the molecular formula C21H24N6S and a molecular weight of 392.53 g/mol. Its IUPAC name is N',N'-diethyl-N-(2-thiophen-2-ylpyrimido[5,4-c]cinnolin-4-yl)propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-(2-thiophen-2-ylpyrimido[5,4-c]cinnolin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 11552915 |
| Molecular Formula | C21H24N6S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | N',N'-diethyl-N-(2-thiophen-2-ylpyrimido[5,4-c]cinnolin-4-yl)propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(-c2cccs2)nc2c1nnc1ccccc12 |
| InChI | InChI=1S/C21H24N6S/c1-3-27(4-2)13-8-12-22-21-19-18(15-9-5-6-10-16(15)25-26-19)23-20(24-21)17-11-7-14-28-17/h5-7,9-11,14H,3-4,8,12-13H2,1-2H3,(H,22,23,24) |
| InChIKey | ZLYWAHKOBZDMLC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|