About N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline
N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline (PubChem CID 11552989) has the molecular formula C23H22FN3
and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline.
Molecular Properties
| Compound Name | N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline |
| PubChem CID | 11552989 |
| Molecular Formula | C23H22FN3 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2c(CNc3ccc(F)cc3)nccc12 |
| InChI | InChI=1S/C23H22FN3/c1-16-17(2)27(15-18-6-4-3-5-7-18)23-21(16)12-13-25-22(23)14-26-20-10-8-19(24)9-11-20/h3-13,26H,14-15H2,1-2H3 |
| InChIKey | XZTALSKGWFQJGO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline?
The IUPAC name of N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline (CID 11552989) is N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline.
What is the SMILES notation for N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline?
The canonical SMILES for N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline is Cc1c(C)n(Cc2ccccc2)c2c(CNc3ccc(F)cc3)nccc12.
What is the InChIKey of N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline?
The InChIKey is XZTALSKGWFQJGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22FN3/c1-16-17(2)27(15-18-6-4-3-5-7-18)23-21(16)12-13-25-22(23)14-26-20-10-8-19(24)9-11-20/h3-13,26H,14-15H2,1-2H3.
What are the key properties of N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline?
N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline has a molecular weight of 359.45 g/mol, XLogP of 5.45, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-benzyl-2,3-dimethylpyrrolo[2,3-c]pyridin-7-yl)methyl]-4-fluoroaniline is sourced from PubChem (CID 11552989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).