About 2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate
2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate (PubChem CID 11552998) has the molecular formula C20H23F3N2O3
and a molecular weight of 396.41 g/mol. Its IUPAC name is 2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate.
Molecular Properties
| Compound Name | 2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate |
| PubChem CID | 11552998 |
| Molecular Formula | C20H23F3N2O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1c(C)cc(CNc2ccc(C(F)(F)F)cc2)cc1C |
| InChI | InChI=1S/C20H23F3N2O3/c1-13-10-15(11-14(2)18(13)25-19(26)28-9-8-27-3)12-24-17-6-4-16(5-7-17)20(21,22)23/h4-7,10-11,24H,8-9,12H2,1-3H3,(H,25,26) |
| InChIKey | UYUQLIZCUOSRRQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate?
The IUPAC name of 2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate (CID 11552998) is 2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate.
What is the SMILES notation for 2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate?
The canonical SMILES for 2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate is COCCOC(=O)Nc1c(C)cc(CNc2ccc(C(F)(F)F)cc2)cc1C.
What is the InChIKey of 2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate?
The InChIKey is UYUQLIZCUOSRRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F3N2O3/c1-13-10-15(11-14(2)18(13)25-19(26)28-9-8-27-3)12-24-17-6-4-16(5-7-17)20(21,22)23/h4-7,10-11,24H,8-9,12H2,1-3H3,(H,25,26).
What are the key properties of 2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate?
2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate has a molecular weight of 396.41 g/mol, XLogP of 5.13, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate is sourced from PubChem (CID 11552998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).