C11H16N2O — CID 115529993
2-cyclobutyl-1-(2-methylpyrimidin-4-yl)ethanol (PubChem CID 115529993) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-cyclobutyl-1-(2-methylpyrimidin-4-yl)ethanol.
| Compound Name | 2-cyclobutyl-1-(2-methylpyrimidin-4-yl)ethanol |
|---|---|
| PubChem CID | 115529993 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-cyclobutyl-1-(2-methylpyrimidin-4-yl)ethanol |
| SMILES | Cc1nccc(C(O)CC2CCC2)n1 |
| InChI | InChI=1S/C11H16N2O/c1-8-12-6-5-10(13-8)11(14)7-9-3-2-4-9/h5-6,9,11,14H,2-4,7H2,1H3 |
| InChIKey | CFZJYXZHOKHNQJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |