C17H25F2NO — CID 115530085
[1-(aminomethyl)-3-ethylcyclohexyl]-[3-(difluoromethyl)phenyl]methanol (PubChem CID 115530085) has the molecular formula C17H25F2NO and a molecular weight of 297.39 g/mol. Its IUPAC name is [1-(aminomethyl)-3-ethylcyclohexyl]-[3-(difluoromethyl)phenyl]methanol.
| Compound Name | [1-(aminomethyl)-3-ethylcyclohexyl]-[3-(difluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 115530085 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | [1-(aminomethyl)-3-ethylcyclohexyl]-[3-(difluoromethyl)phenyl]methanol |
| SMILES | CCC1CCCC(CN)(C(O)c2cccc(C(F)F)c2)C1 |
| InChI | InChI=1S/C17H25F2NO/c1-2-12-5-4-8-17(10-12,11-20)15(21)13-6-3-7-14(9-13)16(18)19/h3,6-7,9,12,15-16,21H,2,4-5,8,10-11,20H2,1H3 |
| InChIKey | NQMKFLFHCPYCSZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |