C14H17N3O2 — CID 115530269
(3,5-dimethoxyphenyl)-(2-methylpyrimidin-4-yl)methanamine (PubChem CID 115530269) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-(2-methylpyrimidin-4-yl)methanamine.
| Compound Name | (3,5-dimethoxyphenyl)-(2-methylpyrimidin-4-yl)methanamine |
|---|---|
| PubChem CID | 115530269 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (3,5-dimethoxyphenyl)-(2-methylpyrimidin-4-yl)methanamine |
| SMILES | COc1cc(OC)cc(C(N)c2ccnc(C)n2)c1 |
| InChI | InChI=1S/C14H17N3O2/c1-9-16-5-4-13(17-9)14(15)10-6-11(18-2)8-12(7-10)19-3/h4-8,14H,15H2,1-3H3 |
| InChIKey | MACVWIZZXQEYSX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |