About 3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide
3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 11553041) has the molecular formula C16H20ClN7O
and a molecular weight of 361.84 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide |
| PubChem CID | 11553041 |
| Molecular Formula | C16H20ClN7O |
| Molecular Weight | 361.84 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCCc1ccccc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C16H20ClN7O/c17-12-14(19)23-13(18)11(22-12)15(25)24-16(20)21-9-5-4-8-10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H4,18,19,23)(H3,20,21,24,25) |
| InChIKey | DSMWIRSXENVRQV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.84 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide?
The IUPAC name of 3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide (CID 11553041) is 3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide.
What is the SMILES notation for 3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide?
The canonical SMILES for 3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide is N/C(=N\CCCCc1ccccc1)NC(=O)c1nc(Cl)c(N)nc1N.
What is the InChIKey of 3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide?
The InChIKey is DSMWIRSXENVRQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClN7O/c17-12-14(19)23-13(18)11(22-12)15(25)24-16(20)21-9-5-4-8-10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2,(H4,18,19,23)(H3,20,21,24,25).
What are the key properties of 3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide?
3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide has a molecular weight of 361.84 g/mol, XLogP of 1.36, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diamino-6-chloro-N-[N'-(4-phenylbutyl)carbamimidoyl]pyrazine-2-carboxamide is sourced from PubChem (CID 11553041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).