About 1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone
1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone (PubChem CID 11553100) has the molecular formula C25H18F2N2O
and a molecular weight of 400.43 g/mol. Its IUPAC name is 1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone |
| PubChem CID | 11553100 |
| Molecular Formula | C25H18F2N2O |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2cc(-c3ccc(F)cc3)nc(-c3ccc(F)cc3)c2)cc1 |
| InChI | InChI=1S/C25H18F2N2O/c1-16(30)17-6-12-22(13-7-17)28-23-14-24(18-2-8-20(26)9-3-18)29-25(15-23)19-4-10-21(27)11-5-19/h2-15H,1H3,(H,28,29) |
| InChIKey | KEXBTBKGVOXVTC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone?
The IUPAC name of 1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone (CID 11553100) is 1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone.
What is the SMILES notation for 1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone?
The canonical SMILES for 1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone is CC(=O)c1ccc(Nc2cc(-c3ccc(F)cc3)nc(-c3ccc(F)cc3)c2)cc1.
What is the InChIKey of 1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone?
The InChIKey is KEXBTBKGVOXVTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18F2N2O/c1-16(30)17-6-12-22(13-7-17)28-23-14-24(18-2-8-20(26)9-3-18)29-25(15-23)19-4-10-21(27)11-5-19/h2-15H,1H3,(H,28,29).
What are the key properties of 1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone?
1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone has a molecular weight of 400.43 g/mol, XLogP of 6.64, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[[2,6-bis(4-fluorophenyl)-4-pyridinyl]amino]phenyl]ethanone is sourced from PubChem (CID 11553100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).