C24H24N4O2 — CID 11553106
1-[4-[(1S,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea (PubChem CID 11553106) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-[4-[(1S,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[4-[(1S,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 11553106 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-[4-[(1S,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]phenyl]-3-(4-phenoxyphenyl)urea |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)cc1)Nc1ccc(N2C[C@H]3C[C@H]2CN3)cc1 |
| InChI | InChI=1S/C24H24N4O2/c29-24(27-18-8-12-23(13-9-18)30-22-4-2-1-3-5-22)26-17-6-10-20(11-7-17)28-16-19-14-21(28)15-25-19/h1-13,19,21,25H,14-16H2,(H2,26,27,29)/t19-,21+/m1/s1 |
| InChIKey | SDJNHNHKBKABHT-CTNGQTDRSA-N |
| XLogP | 4.67 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |