C13H11F3N2O2 — CID 115531652
4-(dimethoxymethyl)-2-(3,4,5-trifluorophenyl)pyrimidine (PubChem CID 115531652) has the molecular formula C13H11F3N2O2 and a molecular weight of 284.24 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-2-(3,4,5-trifluorophenyl)pyrimidine.
| Compound Name | 4-(dimethoxymethyl)-2-(3,4,5-trifluorophenyl)pyrimidine |
|---|---|
| PubChem CID | 115531652 |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-(dimethoxymethyl)-2-(3,4,5-trifluorophenyl)pyrimidine |
| SMILES | COC(OC)c1ccnc(-c2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C13H11F3N2O2/c1-19-13(20-2)10-3-4-17-12(18-10)7-5-8(14)11(16)9(15)6-7/h3-6,13H,1-2H3 |
| InChIKey | VIFNABWUVYAHGZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|