C10H4ClF9Se — CID 11553307
1-chloro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylselanyl)benzene (PubChem CID 11553307) has the molecular formula C10H4ClF9Se and a molecular weight of 409.54 g/mol. Its IUPAC name is 1-chloro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylselanyl)benzene.
| Compound Name | 1-chloro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylselanyl)benzene |
|---|---|
| PubChem CID | 11553307 |
| Molecular Formula | C10H4ClF9Se |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.90 |
| IUPAC Name | 1-chloro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylselanyl)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)[Se]c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H4ClF9Se/c11-5-1-3-6(4-2-5)21-10(19,20)8(14,15)7(12,13)9(16,17)18/h1-4H |
| InChIKey | AWLQMIWXJXRSPR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|