C23H23N7O — CID 11553394
N-(4-morpholin-4-ylphenyl)-4-[3-(1,2,4-triazol-1-ylmethyl)phenyl]pyrimidin-2-amine (PubChem CID 11553394) has the molecular formula C23H23N7O and a molecular weight of 413.49 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-4-[3-(1,2,4-triazol-1-ylmethyl)phenyl]pyrimidin-2-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-4-[3-(1,2,4-triazol-1-ylmethyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 11553394 |
| Molecular Formula | C23H23N7O |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-4-[3-(1,2,4-triazol-1-ylmethyl)phenyl]pyrimidin-2-amine |
| SMILES | c1cc(Cn2cncn2)cc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)c1 |
| InChI | InChI=1S/C23H23N7O/c1-2-18(15-30-17-24-16-26-30)14-19(3-1)22-8-9-25-23(28-22)27-20-4-6-21(7-5-20)29-10-12-31-13-11-29/h1-9,14,16-17H,10-13,15H2,(H,25,27,28) |
| InChIKey | ZUOKQBHDYADAEA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|