C15H21ClN2O3 — CID 115535669
methyl 2-[(4-chloro-1-ethylpyrrole-2-carbonyl)-cyclopentylamino]acetate (PubChem CID 115535669) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is methyl 2-[(4-chloro-1-ethylpyrrole-2-carbonyl)-cyclopentylamino]acetate.
| Compound Name | methyl 2-[(4-chloro-1-ethylpyrrole-2-carbonyl)-cyclopentylamino]acetate |
|---|---|
| PubChem CID | 115535669 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl 2-[(4-chloro-1-ethylpyrrole-2-carbonyl)-cyclopentylamino]acetate |
| SMILES | CCn1cc(Cl)cc1C(=O)N(CC(=O)OC)C1CCCC1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-3-17-9-11(16)8-13(17)15(20)18(10-14(19)21-2)12-6-4-5-7-12/h8-9,12H,3-7,10H2,1-2H3 |
| InChIKey | CDFIXYHDEWAHLW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |