C15H25NO3S — CID 115535772
tert-butyl (2S)-1-(thiane-2-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 115535772) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is tert-butyl (2S)-1-(thiane-2-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-(thiane-2-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 115535772 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | tert-butyl (2S)-1-(thiane-2-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN1C(=O)C1CCCCS1 |
| InChI | InChI=1S/C15H25NO3S/c1-15(2,3)19-14(18)11-7-6-9-16(11)13(17)12-8-4-5-10-20-12/h11-12H,4-10H2,1-3H3/t11-,12?/m0/s1 |
| InChIKey | HDELHPBAFGVVAY-PXYINDEMSA-N |
| XLogP | 2.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |