About methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate
methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate (PubChem CID 115535984) has the molecular formula C13H17N3O5
and a molecular weight of 295.29 g/mol. Its IUPAC name is methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate |
| PubChem CID | 115535984 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCCN1C(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C13H17N3O5/c1-21-13(20)9-4-2-3-7-15(9)12(19)8-16-11(18)6-5-10(17)14-16/h5-6,9H,2-4,7-8H2,1H3,(H,14,17)/t9-/m1/s1 |
| InChIKey | ZVEFVKOCLIHJNV-SECBINFHSA-N |
| XLogP | -0.91 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate?
The IUPAC name of methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate (CID 115535984) is methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate.
What is the SMILES notation for methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate?
The canonical SMILES for methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate is COC(=O)[C@H]1CCCCN1C(=O)Cn1[nH]c(=O)ccc1=O.
What is the InChIKey of methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate?
The InChIKey is ZVEFVKOCLIHJNV-SECBINFHSA-N. The full InChI is InChI=1S/C13H17N3O5/c1-21-13(20)9-4-2-3-7-15(9)12(19)8-16-11(18)6-5-10(17)14-16/h5-6,9H,2-4,7-8H2,1H3,(H,14,17)/t9-/m1/s1.
What are the key properties of methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate?
methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate has a molecular weight of 295.29 g/mol, XLogP of -0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-1-[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]piperidine-2-carboxylate is sourced from PubChem (CID 115535984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).